ChemNet > CAS > 2249-28-7 4- 3-(Trifluoromethyl)phenyl]-4-piperidinol
2249-28-7 4- 3-(Trifluoromethyl)phenyl]-4-piperidinol
상품명칭 |
4- 3-(Trifluoromethyl)phenyl]-4-piperidinol |
별명 |
4-(alpha,alpha,alpha-Trifluoro-m-tolyl)-4-piperidinol; 4-Hydroxy-4(3-Trifluoromethylphenyl)Piperidine |
분자식 |
C12H15F3NO |
분자량 |
246.2488096 |
InChI |
InChI=1/C11H14FNO.CHF2/c12-10-3-1-2-9(8-10)11(14)4-6-13-7-5-11;1-3-2/h1-3,8,13-14H,4-7H2;1H |
cas번호 |
2249-28-7 |
EC번호 |
218-840-3 |
분자 구조 |
|
녹는 점 |
91-95℃ |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|